C13H15N3O4S2 — CID 43839482
3-methyl-2-[(4-nitrophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 43839482) has the molecular formula C13H15N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-methyl-2-[(4-nitrophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | 3-methyl-2-[(4-nitrophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 43839482 |
| Molecular Formula | C13H15N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3-methyl-2-[(4-nitrophenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | CN1C(SCc2ccc([N+](=O)[O-])cc2)=NC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C13H15N3O4S2/c1-15-12-8-22(19,20)7-11(12)14-13(15)21-6-9-2-4-10(5-3-9)16(17)18/h2-5,11-12H,6-8H2,1H3 |
| InChIKey | XYEZYMYANUKWLI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|