C20H20BrFN2O2S2 — CID 43839602
3-(4-bromo-2-fluorophenyl)-2-[(3,4-dimethylphenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide (PubChem CID 43839602) has the molecular formula C20H20BrFN2O2S2 and a molecular weight of 483.43 g/mol. Its IUPAC name is 3-(4-bromo-2-fluorophenyl)-2-[(3,4-dimethylphenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide.
| Compound Name | 3-(4-bromo-2-fluorophenyl)-2-[(3,4-dimethylphenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
|---|---|
| PubChem CID | 43839602 |
| Molecular Formula | C20H20BrFN2O2S2 |
| Molecular Weight | 483.43 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | 3-(4-bromo-2-fluorophenyl)-2-[(3,4-dimethylphenyl)methylsulfanyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole 5,5-dioxide |
| SMILES | Cc1ccc(CSC2=NC3CS(=O)(=O)CC3N2c2ccc(Br)cc2F)cc1C |
| InChI | InChI=1S/C20H20BrFN2O2S2/c1-12-3-4-14(7-13(12)2)9-27-20-23-17-10-28(25,26)11-19(17)24(20)18-6-5-15(21)8-16(18)22/h3-8,17,19H,9-11H2,1-2H3 |
| InChIKey | MUULRENYRODEII-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |