About N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline
N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline (PubChem CID 43839983) has the molecular formula C14H13N5
and a molecular weight of 251.29 g/mol. Its IUPAC name is N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline.
Molecular Properties
| Compound Name | N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline |
| PubChem CID | 43839983 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline |
| SMILES | c1ccc(NCc2nc(-c3ccncc3)n[nH]2)cc1 |
| InChI | InChI=1S/C14H13N5/c1-2-4-12(5-3-1)16-10-13-17-14(19-18-13)11-6-8-15-9-7-11/h1-9,16H,10H2,(H,17,18,19) |
| InChIKey | YKAVZWRGBOWKDP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline?
The IUPAC name of N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline (CID 43839983) is N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline.
What is the SMILES notation for N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline?
The canonical SMILES for N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline is c1ccc(NCc2nc(-c3ccncc3)n[nH]2)cc1.
What is the InChIKey of N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline?
The InChIKey is YKAVZWRGBOWKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5/c1-2-4-12(5-3-1)16-10-13-17-14(19-18-13)11-6-8-15-9-7-11/h1-9,16H,10H2,(H,17,18,19).
What are the key properties of N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline?
N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline has a molecular weight of 251.29 g/mol, XLogP of 2.48, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methyl]aniline is sourced from PubChem (CID 43839983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).