C25H20N4O3 — CID 43841356
3-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 43841356) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 3-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43841356 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 3-(1,2-dihydroimidazo[1,2-a]benzimidazol-3-yl)-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCn3c2nc2ccccc23)C(=O)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N4O3/c30-23-16-22(28-15-14-27-21-9-5-4-8-20(21)26-25(27)28)24(31)29(23)17-10-12-19(13-11-17)32-18-6-2-1-3-7-18/h1-13,22H,14-16H2 |
| InChIKey | UQPUOFGQTQVQAS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|