C19H22N4O — CID 43841543
1-(2-methoxyethyl)-3-(2-pyrrolidin-1-ylpyrimidin-4-yl)indole (PubChem CID 43841543) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(2-pyrrolidin-1-ylpyrimidin-4-yl)indole.
| Compound Name | 1-(2-methoxyethyl)-3-(2-pyrrolidin-1-ylpyrimidin-4-yl)indole |
|---|---|
| PubChem CID | 43841543 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(2-pyrrolidin-1-ylpyrimidin-4-yl)indole |
| SMILES | COCCn1cc(-c2ccnc(N3CCCC3)n2)c2ccccc21 |
| InChI | InChI=1S/C19H22N4O/c1-24-13-12-23-14-16(15-6-2-3-7-18(15)23)17-8-9-20-19(21-17)22-10-4-5-11-22/h2-3,6-9,14H,4-5,10-13H2,1H3 |
| InChIKey | SKRDSTDQXGAHQE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |