About ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate
ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate (PubChem CID 43841771) has the molecular formula C10H10N4O5
and a molecular weight of 266.21 g/mol. Its IUPAC name is ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate |
| PubChem CID | 43841771 |
| Molecular Formula | C10H10N4O5 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1cn(CC#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H10N4O5/c1-2-19-10(18)13-8(16)6-5-14(4-3-11)9(17)12-7(6)15/h5H,2,4H2,1H3,(H,12,15,17)(H,13,16,18) |
| InChIKey | GWVKDWSAFKQMGE-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 134.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate?
The IUPAC name of ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate (CID 43841771) is ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate.
What is the SMILES notation for ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate?
The canonical SMILES for ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate is CCOC(=O)NC(=O)c1cn(CC#N)c(=O)[nH]c1=O.
What is the InChIKey of ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate?
The InChIKey is GWVKDWSAFKQMGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O5/c1-2-19-10(18)13-8(16)6-5-14(4-3-11)9(17)12-7(6)15/h5H,2,4H2,1H3,(H,12,15,17)(H,13,16,18).
What are the key properties of ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate?
ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate has a molecular weight of 266.21 g/mol, XLogP of -1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[1-(cyanomethyl)-2,4-dioxopyrimidine-5-carbonyl]carbamate is sourced from PubChem (CID 43841771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).