C12H14O2S — CID 43841897
3-(2,5-dimethylphenyl)-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 43841897) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | 3-(2,5-dimethylphenyl)-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 43841897 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | Cc1ccc(C)c(C2C=CS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H14O2S/c1-9-3-4-10(2)12(7-9)11-5-6-15(13,14)8-11/h3-7,11H,8H2,1-2H3 |
| InChIKey | XDZVBGAUQPLSNL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |