C16H14N2O2S2 — CID 43842498
3-(15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl)propanenitrile (PubChem CID 43842498) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-(15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl)propanenitrile.
| Compound Name | 3-(15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl)propanenitrile |
|---|---|
| PubChem CID | 43842498 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3-(15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraen-14-yl)propanenitrile |
| SMILES | N#CCCn1c2c(sc1=O)C1c3ccccc3OCC1CS2 |
| InChI | InChI=1S/C16H14N2O2S2/c17-6-3-7-18-15-14(22-16(18)19)13-10(9-21-15)8-20-12-5-2-1-4-11(12)13/h1-2,4-5,10,13H,3,7-9H2 |
| InChIKey | KWSCKUKCRVAFGH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|