C23H23N3O4S — CID 43842792
N-[3-(methylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazole-3-carboxamide (PubChem CID 43842792) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is N-[3-(methylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(methylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 43842792 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[3-(methylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CNC(=O)c1c(NC(=O)c2cc(-c3ccc4c(c3)CC(C)O4)on2)sc2c1CCCC2 |
| InChI | InChI=1S/C23H23N3O4S/c1-12-9-14-10-13(7-8-17(14)29-12)18-11-16(26-30-18)21(27)25-23-20(22(28)24-2)15-5-3-4-6-19(15)31-23/h7-8,10-12H,3-6,9H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | POSHEPBTCURAQL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |