C7H8BrN3OS — CID 43845275
6-(bromomethyl)-3-methyl-6,7-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 43845275) has the molecular formula C7H8BrN3OS and a molecular weight of 262.13 g/mol. Its IUPAC name is 6-(bromomethyl)-3-methyl-6,7-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 6-(bromomethyl)-3-methyl-6,7-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 43845275 |
| Molecular Formula | C7H8BrN3OS |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 6-(bromomethyl)-3-methyl-6,7-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | Cc1nnc2n(c1=O)C(CBr)CS2 |
| InChI | InChI=1S/C7H8BrN3OS/c1-4-6(12)11-5(2-8)3-13-7(11)10-9-4/h5H,2-3H2,1H3 |
| InChIKey | VZGQPTGYVZUQND-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|