C22H22F2N6OS — CID 43845716
4-N-[4-(difluoromethylsulfanyl)phenyl]-6-N-(2-ethoxyethyl)-1-phenylpyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 43845716) has the molecular formula C22H22F2N6OS and a molecular weight of 456.52 g/mol. Its IUPAC name is 4-N-[4-(difluoromethylsulfanyl)phenyl]-6-N-(2-ethoxyethyl)-1-phenylpyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[4-(difluoromethylsulfanyl)phenyl]-6-N-(2-ethoxyethyl)-1-phenylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 43845716 |
| Molecular Formula | C22H22F2N6OS |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 4-N-[4-(difluoromethylsulfanyl)phenyl]-6-N-(2-ethoxyethyl)-1-phenylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | CCOCCNc1nc(Nc2ccc(SC(F)F)cc2)c2cnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H22F2N6OS/c1-2-31-13-12-25-22-28-19(27-15-8-10-17(11-9-15)32-21(23)24)18-14-26-30(20(18)29-22)16-6-4-3-5-7-16/h3-11,14,21H,2,12-13H2,1H3,(H2,25,27,28,29) |
| InChIKey | GSZCEZITTYSJQN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|