C31H27BrN4O5S2 — CID 43846990
2-[11-(4-bromophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 43846990) has the molecular formula C31H27BrN4O5S2 and a molecular weight of 679.62 g/mol. Its IUPAC name is 2-[11-(4-bromophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[11-(4-bromophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43846990 |
| Molecular Formula | C31H27BrN4O5S2 |
| Molecular Weight | 679.62 g/mol |
| Exact Mass | 678.06 |
| IUPAC Name | 2-[11-(4-bromophenyl)-8-[4-(dimethylamino)phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c3c(sc2=O)C(c2ccc(N(C)C)cc2)C2C(=O)N(c4ccc(Br)cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C31H27BrN4O5S2/c1-34(2)20-10-4-17(5-11-20)24-25-26(29(39)36(28(25)38)21-12-6-18(32)7-13-21)42-30-27(24)43-31(40)35(30)16-23(37)33-19-8-14-22(41-3)15-9-19/h4-15,24-26H,16H2,1-3H3,(H,33,37) |
| InChIKey | QJLSHSPOJRVNNZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|