C28H20FN3O4S2 — CID 43848148
2-[8-(4-fluorophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide (PubChem CID 43848148) has the molecular formula C28H20FN3O4S2 and a molecular weight of 545.62 g/mol. Its IUPAC name is 2-[8-(4-fluorophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide.
| Compound Name | 2-[8-(4-fluorophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 43848148 |
| Molecular Formula | C28H20FN3O4S2 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 2-[8-(4-fluorophenyl)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1ccc(F)cc1)C1C(=O)N(c3ccccc3)C(=O)C1S2)Nc1ccccc1 |
| InChI | InChI=1S/C28H20FN3O4S2/c29-17-13-11-16(12-14-17)21-22-23(26(35)32(25(22)34)19-9-5-2-6-10-19)37-27-24(21)38-28(36)31(27)15-20(33)30-18-7-3-1-4-8-18/h1-14,21-23H,15H2,(H,30,33) |
| InChIKey | LHHRCLLBQUOIJF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|