C35H31N3O6S2 — CID 43851302
2-[2-methoxy-4-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 43851302) has the molecular formula C35H31N3O6S2 and a molecular weight of 653.78 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-methoxy-4-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43851302 |
| Molecular Formula | C35H31N3O6S2 |
| Molecular Weight | 653.78 g/mol |
| Exact Mass | 653.17 |
| IUPAC Name | 2-[2-methoxy-4-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc([C@H]2c3sc(=O)[nH]c3SC3C2[C@H]2C[C@@H]3C3C(=O)N(c4ccccc4)C(=O)C32)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C35H31N3O6S2/c1-17-8-11-19(12-9-17)36-25(39)16-44-23-13-10-18(14-24(23)43-2)26-27-21-15-22(30(27)45-32-31(26)46-35(42)37-32)29-28(21)33(40)38(34(29)41)20-6-4-3-5-7-20/h3-14,21-22,26-30H,15-16H2,1-2H3,(H,36,39)(H,37,42)/t21-,22-,26-,27?,28?,29?,30?/m1/s1 |
| InChIKey | PFKGMXDEFYEPEK-OZGMHLJRSA-N |
| XLogP | 5.45 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|