C21H18F3N3O2 — CID 43853764
3-(4-phenylpiperazine-1-carbonyl)-8-(trifluoromethyl)-1H-quinolin-4-one (PubChem CID 43853764) has the molecular formula C21H18F3N3O2 and a molecular weight of 401.39 g/mol. Its IUPAC name is 3-(4-phenylpiperazine-1-carbonyl)-8-(trifluoromethyl)-1H-quinolin-4-one.
| Compound Name | 3-(4-phenylpiperazine-1-carbonyl)-8-(trifluoromethyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 43853764 |
| Molecular Formula | C21H18F3N3O2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-(4-phenylpiperazine-1-carbonyl)-8-(trifluoromethyl)-1H-quinolin-4-one |
| SMILES | O=C(c1c[nH]c2c(C(F)(F)F)cccc2c1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H18F3N3O2/c22-21(23,24)17-8-4-7-15-18(17)25-13-16(19(15)28)20(29)27-11-9-26(10-12-27)14-5-2-1-3-6-14/h1-8,13H,9-12H2,(H,25,28) |
| InChIKey | LHQFSDMMFPUIKW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |