C24H27N3O4 — CID 43854566
4-(3-methoxypropyl)-9-(4-propan-2-ylphenyl)-9,10-dihydro-8H-pyrimido[4,5-c]isoquinoline-1,3,7-trione (PubChem CID 43854566) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-9-(4-propan-2-ylphenyl)-9,10-dihydro-8H-pyrimido[4,5-c]isoquinoline-1,3,7-trione.
| Compound Name | 4-(3-methoxypropyl)-9-(4-propan-2-ylphenyl)-9,10-dihydro-8H-pyrimido[4,5-c]isoquinoline-1,3,7-trione |
|---|---|
| PubChem CID | 43854566 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-(3-methoxypropyl)-9-(4-propan-2-ylphenyl)-9,10-dihydro-8H-pyrimido[4,5-c]isoquinoline-1,3,7-trione |
| SMILES | COCCCn1c(=O)[nH]c(=O)c2c3c(cnc21)C(=O)CC(c1ccc(C(C)C)cc1)C3 |
| InChI | InChI=1S/C24H27N3O4/c1-14(2)15-5-7-16(8-6-15)17-11-18-19(20(28)12-17)13-25-22-21(18)23(29)26-24(30)27(22)9-4-10-31-3/h5-8,13-14,17H,4,9-12H2,1-3H3,(H,26,29,30) |
| InChIKey | HKRJAEXXGPBZMH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|