About S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate
S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate (PubChem CID 43854669) has the molecular formula C18H15NOS2
and a molecular weight of 325.46 g/mol. Its IUPAC name is S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate |
| PubChem CID | 43854669 |
| Molecular Formula | C18H15NOS2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate |
| SMILES | Cc1ccc(SC(=O)c2nc(C)sc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15NOS2/c1-12-8-10-15(11-9-12)22-18(20)16-17(21-13(2)19-16)14-6-4-3-5-7-14/h3-11H,1-2H3 |
| InChIKey | HSXFQOWVKADEIY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate?
The IUPAC name of S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate (CID 43854669) is S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate.
What is the SMILES notation for S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate?
The canonical SMILES for S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate is Cc1ccc(SC(=O)c2nc(C)sc2-c2ccccc2)cc1.
What is the InChIKey of S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate?
The InChIKey is HSXFQOWVKADEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NOS2/c1-12-8-10-15(11-9-12)22-18(20)16-17(21-13(2)19-16)14-6-4-3-5-7-14/h3-11H,1-2H3.
What are the key properties of S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate?
S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate has a molecular weight of 325.46 g/mol, XLogP of 5.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) 2-methyl-5-phenyl-1,3-thiazole-4-carbothioate is sourced from PubChem (CID 43854669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).