C23H20N4O3S — CID 43855070
2-methyl-N-[4-(3-methyl-4-prop-2-enoxyphenyl)-1,2,5-oxadiazol-3-yl]-5-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 43855070) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-methyl-N-[4-(3-methyl-4-prop-2-enoxyphenyl)-1,2,5-oxadiazol-3-yl]-5-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-methyl-N-[4-(3-methyl-4-prop-2-enoxyphenyl)-1,2,5-oxadiazol-3-yl]-5-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 43855070 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-methyl-N-[4-(3-methyl-4-prop-2-enoxyphenyl)-1,2,5-oxadiazol-3-yl]-5-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCOc1ccc(-c2nonc2NC(=O)c2nc(C)sc2-c2ccccc2)cc1C |
| InChI | InChI=1S/C23H20N4O3S/c1-4-12-29-18-11-10-17(13-14(18)2)19-22(27-30-26-19)25-23(28)20-21(31-15(3)24-20)16-8-6-5-7-9-16/h4-11,13H,1,12H2,2-3H3,(H,25,27,28) |
| InChIKey | FUCVEPIBYHDUAV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|