C24H26ClN3O3 — CID 43857505
3-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)-5-pentyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 43857505) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)-5-pentyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)-5-pentyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 43857505 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)-5-pentyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CCCCCN1C(=O)c2[nH]nc(-c3ccc(Cl)cc3)c2C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H26ClN3O3/c1-4-5-6-13-28-23(16-9-12-18(30-2)19(14-16)31-3)20-21(26-27-22(20)24(28)29)15-7-10-17(25)11-8-15/h7-12,14,23H,4-6,13H2,1-3H3,(H,26,27) |
| InChIKey | APZSUYBCTAJVFZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|