C16H15F3N2O5S — CID 43860505
2-acetamido-3-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 43860505) has the molecular formula C16H15F3N2O5S and a molecular weight of 404.37 g/mol. Its IUPAC name is 2-acetamido-3-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43860505 |
| Molecular Formula | C16H15F3N2O5S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-acetamido-3-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CSC1CC(=O)N(c2cccc(C(F)(F)F)c2)C1=O)C(=O)O |
| InChI | InChI=1S/C16H15F3N2O5S/c1-8(22)20-11(15(25)26)7-27-12-6-13(23)21(14(12)24)10-4-2-3-9(5-10)16(17,18)19/h2-5,11-12H,6-7H2,1H3,(H,20,22)(H,25,26) |
| InChIKey | DKJTYBTWNIXCTD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|