C10H13N3O2S2 — CID 43860629
3-ethylsulfanyl-1-(5-ethyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,5-dione (PubChem CID 43860629) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 3-ethylsulfanyl-1-(5-ethyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-ethylsulfanyl-1-(5-ethyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43860629 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3-ethylsulfanyl-1-(5-ethyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,5-dione |
| SMILES | CCSC1CC(=O)N(c2nnc(CC)s2)C1=O |
| InChI | InChI=1S/C10H13N3O2S2/c1-3-7-11-12-10(17-7)13-8(14)5-6(9(13)15)16-4-2/h6H,3-5H2,1-2H3 |
| InChIKey | AWTRZPHVXASDLY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|