C15H16N4O4S3 — CID 43860654
4-[3-(2-aminoethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 43860654) has the molecular formula C15H16N4O4S3 and a molecular weight of 412.52 g/mol. Its IUPAC name is 4-[3-(2-aminoethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[3-(2-aminoethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43860654 |
| Molecular Formula | C15H16N4O4S3 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 4-[3-(2-aminoethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | NCCSC1CC(=O)N(c2ccc(S(=O)(=O)Nc3nccs3)cc2)C1=O |
| InChI | InChI=1S/C15H16N4O4S3/c16-5-7-24-12-9-13(20)19(14(12)21)10-1-3-11(4-2-10)26(22,23)18-15-17-6-8-25-15/h1-4,6,8,12H,5,7,9,16H2,(H,17,18) |
| InChIKey | LZTSXHBYNORCBY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|