C19H22N2O6 — CID 43861105
5-[3-(2-ethylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid (PubChem CID 43861105) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is 5-[3-(2-ethylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[3-(2-ethylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 43861105 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 5-[3-(2-ethylpiperidin-1-yl)-2,5-dioxopyrrolidin-1-yl]benzene-1,3-dicarboxylic acid |
| SMILES | CCC1CCCCN1C1CC(=O)N(c2cc(C(=O)O)cc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C19H22N2O6/c1-2-13-5-3-4-6-20(13)15-10-16(22)21(17(15)23)14-8-11(18(24)25)7-12(9-14)19(26)27/h7-9,13,15H,2-6,10H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | UQAMRVBDHRIMFI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|