C18H14F3N5O4 — CID 43864375
4-(trifluoromethyl)-11-(3,4,5-trimethoxyphenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 43864375) has the molecular formula C18H14F3N5O4 and a molecular weight of 421.34 g/mol. Its IUPAC name is 4-(trifluoromethyl)-11-(3,4,5-trimethoxyphenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-(trifluoromethyl)-11-(3,4,5-trimethoxyphenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 43864375 |
| Molecular Formula | C18H14F3N5O4 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-(trifluoromethyl)-11-(3,4,5-trimethoxyphenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COc1cc(-n2ccc3c(cnc4nc(C(F)(F)F)nn43)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H14F3N5O4/c1-28-12-6-9(7-13(29-2)14(12)30-3)25-5-4-11-10(15(25)27)8-22-17-23-16(18(19,20)21)24-26(11)17/h4-8H,1-3H3 |
| InChIKey | XNMNNEFEFPWERE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |