C18H13ClN8O2 — CID 43864929
8-(4-chlorophenyl)-11-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one (PubChem CID 43864929) has the molecular formula C18H13ClN8O2 and a molecular weight of 408.81 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-11-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one.
| Compound Name | 8-(4-chlorophenyl)-11-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one |
|---|---|
| PubChem CID | 43864929 |
| Molecular Formula | C18H13ClN8O2 |
| Molecular Weight | 408.81 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 8-(4-chlorophenyl)-11-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one |
| SMILES | COCc1nc(-n2ccc3nc4ncnn4c(-c4ccc(Cl)cc4)c3c2=O)n[nH]1 |
| InChI | InChI=1S/C18H13ClN8O2/c1-29-8-13-23-18(25-24-13)26-7-6-12-14(16(26)28)15(10-2-4-11(19)5-3-10)27-17(22-12)20-9-21-27/h2-7,9H,8H2,1H3,(H,23,24,25) |
| InChIKey | HBUOVHAOTIZGQS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.81 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |