C22H22N4O2 — CID 43865004
8-[3-(dimethylamino)propyl]-2-phenylpyrido[4,3-b][1,6]naphthyridine-1,9-dione (PubChem CID 43865004) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 8-[3-(dimethylamino)propyl]-2-phenylpyrido[4,3-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 8-[3-(dimethylamino)propyl]-2-phenylpyrido[4,3-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 43865004 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 8-[3-(dimethylamino)propyl]-2-phenylpyrido[4,3-b][1,6]naphthyridine-1,9-dione |
| SMILES | CN(C)CCCn1ccc2nc3ccn(-c4ccccc4)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C22H22N4O2/c1-24(2)11-6-12-25-13-9-19-17(21(25)27)15-18-20(23-19)10-14-26(22(18)28)16-7-4-3-5-8-16/h3-5,7-10,13-15H,6,11-12H2,1-2H3 |
| InChIKey | DWJBYMHPEHGDCW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|