C21H18N4O2 — CID 43865142
8-cyclopentyl-2-pyridin-4-ylpyrido[4,3-b][1,6]naphthyridine-1,9-dione (PubChem CID 43865142) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 8-cyclopentyl-2-pyridin-4-ylpyrido[4,3-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 8-cyclopentyl-2-pyridin-4-ylpyrido[4,3-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 43865142 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 8-cyclopentyl-2-pyridin-4-ylpyrido[4,3-b][1,6]naphthyridine-1,9-dione |
| SMILES | O=c1c2cc3c(=O)n(C4CCCC4)ccc3nc2ccn1-c1ccncc1 |
| InChI | InChI=1S/C21H18N4O2/c26-20-16-13-17-19(8-12-25(21(17)27)15-5-9-22-10-6-15)23-18(16)7-11-24(20)14-3-1-2-4-14/h5-14H,1-4H2 |
| InChIKey | WJNHHBBFKATMRE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|