C21H27Cl2N5O2 — CID 43865603
1-(3,5-dichlorophenyl)-7,8-dimethyl-3-(3-morpholin-4-ylpropyl)-2,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one (PubChem CID 43865603) has the molecular formula C21H27Cl2N5O2 and a molecular weight of 452.39 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-7,8-dimethyl-3-(3-morpholin-4-ylpropyl)-2,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one.
| Compound Name | 1-(3,5-dichlorophenyl)-7,8-dimethyl-3-(3-morpholin-4-ylpropyl)-2,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 43865603 |
| Molecular Formula | C21H27Cl2N5O2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-7,8-dimethyl-3-(3-morpholin-4-ylpropyl)-2,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
| SMILES | Cc1nc2n(c(=O)c1C)CN(CCCN1CCOCC1)CN2c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H27Cl2N5O2/c1-15-16(2)24-21-27(19-11-17(22)10-18(23)12-19)13-26(14-28(21)20(15)29)5-3-4-25-6-8-30-9-7-25/h10-12H,3-9,13-14H2,1-2H3 |
| InChIKey | NOFBCRAXGUHIKI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |