C22H22N2O4S — CID 43865796
6-(4-ethoxyphenyl)sulfonyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-one (PubChem CID 43865796) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)sulfonyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-one.
| Compound Name | 6-(4-ethoxyphenyl)sulfonyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-one |
|---|---|
| PubChem CID | 43865796 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 6-(4-ethoxyphenyl)sulfonyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-one |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCc3c4n(c5ccccc35)C(=O)CCC42)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-2-28-15-7-9-16(10-8-15)29(26,27)23-14-13-18-17-5-3-4-6-19(17)24-21(25)12-11-20(23)22(18)24/h3-10,20H,2,11-14H2,1H3 |
| InChIKey | NEJHACKZAFLSAK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |