C23H23N5O3 — CID 43865881
5-[[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]amino]-2-(2-nitrophenyl)-1,3-oxazole-4-carbonitrile (PubChem CID 43865881) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 5-[[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]amino]-2-(2-nitrophenyl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]amino]-2-(2-nitrophenyl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 43865881 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 5-[[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]amino]-2-(2-nitrophenyl)-1,3-oxazole-4-carbonitrile |
| SMILES | Cc1ccc(C(CNc2oc(-c3ccccc3[N+](=O)[O-])nc2C#N)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H23N5O3/c1-16-8-10-17(11-9-16)21(27-12-4-5-13-27)15-25-23-19(14-24)26-22(31-23)18-6-2-3-7-20(18)28(29)30/h2-3,6-11,21,25H,4-5,12-13,15H2,1H3 |
| InChIKey | KWSDWEINJJAVJR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|