C21H21NO3 — CID 43865947
1-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)naphthalen-2-ol (PubChem CID 43865947) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)naphthalen-2-ol.
| Compound Name | 1-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 43865947 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)naphthalen-2-ol |
| SMILES | COc1cc2c(cc1OC)C(c1c(O)ccc3ccccc13)NCC2 |
| InChI | InChI=1S/C21H21NO3/c1-24-18-11-14-9-10-22-21(16(14)12-19(18)25-2)20-15-6-4-3-5-13(15)7-8-17(20)23/h3-8,11-12,21-23H,9-10H2,1-2H3 |
| InChIKey | HKLKGEIEZNATJU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|