About 3,8-diethylquinolin-2-amine;hydrochloride
3,8-diethylquinolin-2-amine;hydrochloride (PubChem CID 43866005) has the molecular formula C13H17ClN2
and a molecular weight of 236.75 g/mol. Its IUPAC name is 3,8-diethylquinolin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 3,8-diethylquinolin-2-amine;hydrochloride |
| PubChem CID | 43866005 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3,8-diethylquinolin-2-amine;hydrochloride |
| SMILES | CCc1cc2cccc(CC)c2nc1N.Cl |
| InChI | InChI=1S/C13H16N2.ClH/c1-3-9-6-5-7-11-8-10(4-2)13(14)15-12(9)11;/h5-8H,3-4H2,1-2H3,(H2,14,15);1H |
| InChIKey | KOBXZARBXPMFGE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,8-diethylquinolin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-diethylquinolin-2-amine;hydrochloride?
The IUPAC name of 3,8-diethylquinolin-2-amine;hydrochloride (CID 43866005) is 3,8-diethylquinolin-2-amine;hydrochloride.
What is the SMILES notation for 3,8-diethylquinolin-2-amine;hydrochloride?
The canonical SMILES for 3,8-diethylquinolin-2-amine;hydrochloride is CCc1cc2cccc(CC)c2nc1N.Cl.
What is the InChIKey of 3,8-diethylquinolin-2-amine;hydrochloride?
The InChIKey is KOBXZARBXPMFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2.ClH/c1-3-9-6-5-7-11-8-10(4-2)13(14)15-12(9)11;/h5-8H,3-4H2,1-2H3,(H2,14,15);1H.
What are the key properties of 3,8-diethylquinolin-2-amine;hydrochloride?
3,8-diethylquinolin-2-amine;hydrochloride has a molecular weight of 236.75 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-diethylquinolin-2-amine;hydrochloride is sourced from PubChem (CID 43866005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).