C25H21F3N4O3S — CID 43869428
2-[[5-[1-(2-methoxyphenoxy)ethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 43869428) has the molecular formula C25H21F3N4O3S and a molecular weight of 514.53 g/mol. Its IUPAC name is 2-[[5-[1-(2-methoxyphenoxy)ethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[5-[1-(2-methoxyphenoxy)ethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 43869428 |
| Molecular Formula | C25H21F3N4O3S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 2-[[5-[1-(2-methoxyphenoxy)ethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | COc1ccccc1OC(C)c1nnc(SCC(=O)Nc2ccc(F)c(F)c2F)n1-c1ccccc1 |
| InChI | InChI=1S/C25H21F3N4O3S/c1-15(35-20-11-7-6-10-19(20)34-2)24-30-31-25(32(24)16-8-4-3-5-9-16)36-14-21(33)29-18-13-12-17(26)22(27)23(18)28/h3-13,15H,14H2,1-2H3,(H,29,33) |
| InChIKey | BROHCEGXFZWNAK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|