C19H22BrClN2O4S — CID 43872610
N-[1-(4-bromophenyl)ethyl]-2-[(3-chloro-4-ethoxyphenyl)sulfonyl-methylamino]acetamide (PubChem CID 43872610) has the molecular formula C19H22BrClN2O4S and a molecular weight of 489.82 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-2-[(3-chloro-4-ethoxyphenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-2-[(3-chloro-4-ethoxyphenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 43872610 |
| Molecular Formula | C19H22BrClN2O4S |
| Molecular Weight | 489.82 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-2-[(3-chloro-4-ethoxyphenyl)sulfonyl-methylamino]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(C)CC(=O)NC(C)c2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C19H22BrClN2O4S/c1-4-27-18-10-9-16(11-17(18)21)28(25,26)23(3)12-19(24)22-13(2)14-5-7-15(20)8-6-14/h5-11,13H,4,12H2,1-3H3,(H,22,24) |
| InChIKey | BBOOYTLYPOQEIT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |