C23H30N2O2 — CID 43876397
N-[(4-methoxyphenyl)methyl]-N-methyl-4-[(3-methylpiperidin-1-yl)methyl]benzamide (PubChem CID 43876397) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N-methyl-4-[(3-methylpiperidin-1-yl)methyl]benzamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N-methyl-4-[(3-methylpiperidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43876397 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N-methyl-4-[(3-methylpiperidin-1-yl)methyl]benzamide |
| SMILES | COc1ccc(CN(C)C(=O)c2ccc(CN3CCCC(C)C3)cc2)cc1 |
| InChI | InChI=1S/C23H30N2O2/c1-18-5-4-14-25(15-18)17-20-6-10-21(11-7-20)23(26)24(2)16-19-8-12-22(27-3)13-9-19/h6-13,18H,4-5,14-17H2,1-3H3 |
| InChIKey | YMQPXELWEAUWNF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |