C21H26ClNO3 — CID 43876417
2-(3-chlorophenoxy)-N-[3-(4-propan-2-yloxyphenyl)propyl]propanamide (PubChem CID 43876417) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[3-(4-propan-2-yloxyphenyl)propyl]propanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[3-(4-propan-2-yloxyphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 43876417 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[3-(4-propan-2-yloxyphenyl)propyl]propanamide |
| SMILES | CC(C)Oc1ccc(CCCNC(=O)C(C)Oc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H26ClNO3/c1-15(2)25-19-11-9-17(10-12-19)6-5-13-23-21(24)16(3)26-20-8-4-7-18(22)14-20/h4,7-12,14-16H,5-6,13H2,1-3H3,(H,23,24) |
| InChIKey | PVFPJODDHNIWGL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|