C24H25NO3 — CID 43876954
2-(3,4-dimethylphenoxy)-N-(2-phenoxyphenyl)butanamide (PubChem CID 43876954) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-(2-phenoxyphenyl)butanamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-(2-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 43876954 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-(2-phenoxyphenyl)butanamide |
| SMILES | CCC(Oc1ccc(C)c(C)c1)C(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C24H25NO3/c1-4-22(28-20-15-14-17(2)18(3)16-20)24(26)25-21-12-8-9-13-23(21)27-19-10-6-5-7-11-19/h5-16,22H,4H2,1-3H3,(H,25,26) |
| InChIKey | ZBJBYHQZQKSSNS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |