C27H30N2O3 — CID 43877767
3-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 43877767) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 43877767 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 3-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)Nc2cccc(C(=O)NC(C)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C27H30N2O3/c1-18(2)24-14-13-19(3)15-25(24)32-17-26(30)29-23-12-8-11-22(16-23)27(31)28-20(4)21-9-6-5-7-10-21/h5-16,18,20H,17H2,1-4H3,(H,28,31)(H,29,30) |
| InChIKey | JBBFKHQXAYKHON-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |