C24H22ClFN2O3 — CID 43877932
N-(3-chloro-4-fluorophenyl)-3-[2-(3-methylphenoxy)butanoylamino]benzamide (PubChem CID 43877932) has the molecular formula C24H22ClFN2O3 and a molecular weight of 440.90 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[2-(3-methylphenoxy)butanoylamino]benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[2-(3-methylphenoxy)butanoylamino]benzamide |
|---|---|
| PubChem CID | 43877932 |
| Molecular Formula | C24H22ClFN2O3 |
| Molecular Weight | 440.90 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[2-(3-methylphenoxy)butanoylamino]benzamide |
| SMILES | CCC(Oc1cccc(C)c1)C(=O)Nc1cccc(C(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C24H22ClFN2O3/c1-3-22(31-19-9-4-6-15(2)12-19)24(30)28-17-8-5-7-16(13-17)23(29)27-18-10-11-21(26)20(25)14-18/h4-14,22H,3H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | UNAPRJJDYHGOHR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.90 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |