C26H27N3O4S — CID 43879777
2-[N-(benzenesulfonyl)-2-methylanilino]-N-[(E)-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]acetamide (PubChem CID 43879777) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-methylanilino]-N-[(E)-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-methylanilino]-N-[(E)-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 43879777 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-methylanilino]-N-[(E)-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)amino]acetamide |
| SMILES | COc1ccc2c(c1)CCC/C2=N\NC(=O)CN(c1ccccc1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O4S/c1-19-9-6-7-14-25(19)29(34(31,32)22-11-4-3-5-12-22)18-26(30)28-27-24-13-8-10-20-17-21(33-2)15-16-23(20)24/h3-7,9,11-12,14-17H,8,10,13,18H2,1-2H3,(H,28,30)/b27-24+ |
| InChIKey | RFTZIXTZCUNRGM-SOYKGTTHSA-N |
| XLogP | 4.06 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|