C26H21BrFN3O5S2 — CID 43881103
2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[4-[(4-bromophenyl)sulfamoyl]phenyl]acetamide (PubChem CID 43881103) has the molecular formula C26H21BrFN3O5S2 and a molecular weight of 618.51 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[4-[(4-bromophenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[4-[(4-bromophenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 43881103 |
| Molecular Formula | C26H21BrFN3O5S2 |
| Molecular Weight | 618.51 g/mol |
| Exact Mass | 617.01 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-fluoroanilino]-N-[4-[(4-bromophenyl)sulfamoyl]phenyl]acetamide |
| SMILES | O=C(CN(c1ccc(F)cc1)S(=O)(=O)c1ccccc1)Nc1ccc(S(=O)(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C26H21BrFN3O5S2/c27-19-6-10-22(11-7-19)30-37(33,34)24-16-12-21(13-17-24)29-26(32)18-31(23-14-8-20(28)9-15-23)38(35,36)25-4-2-1-3-5-25/h1-17,30H,18H2,(H,29,32) |
| InChIKey | UVIIOOJLIBMHGI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |