C28H21F3N2O3S2 — CID 43881579
2-(9H-fluoren-9-ylsulfanyl)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 43881579) has the molecular formula C28H21F3N2O3S2 and a molecular weight of 554.62 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylsulfanyl)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(9H-fluoren-9-ylsulfanyl)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 43881579 |
| Molecular Formula | C28H21F3N2O3S2 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | 2-(9H-fluoren-9-ylsulfanyl)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | O=C(CSC1c2ccccc2-c2ccccc21)Nc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C28H21F3N2O3S2/c29-28(30,31)18-6-5-7-20(16-18)33-38(35,36)21-14-12-19(13-15-21)32-26(34)17-37-27-24-10-3-1-8-22(24)23-9-2-4-11-25(23)27/h1-16,27,33H,17H2,(H,32,34) |
| InChIKey | KCYPWQXUWAXKMF-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |