C23H25N3O6S2 — CID 43882438
2-(4-methoxy-N-methylsulfonylanilino)-N-[4-(phenylsulfamoyl)phenyl]propanamide (PubChem CID 43882438) has the molecular formula C23H25N3O6S2 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-(4-methoxy-N-methylsulfonylanilino)-N-[4-(phenylsulfamoyl)phenyl]propanamide.
| Compound Name | 2-(4-methoxy-N-methylsulfonylanilino)-N-[4-(phenylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 43882438 |
| Molecular Formula | C23H25N3O6S2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 2-(4-methoxy-N-methylsulfonylanilino)-N-[4-(phenylsulfamoyl)phenyl]propanamide |
| SMILES | COc1ccc(N(C(C)C(=O)Nc2ccc(S(=O)(=O)Nc3ccccc3)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H25N3O6S2/c1-17(26(33(3,28)29)20-11-13-21(32-2)14-12-20)23(27)24-18-9-15-22(16-10-18)34(30,31)25-19-7-5-4-6-8-19/h4-17,25H,1-3H3,(H,24,27) |
| InChIKey | JYEUATZJUWMSTH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |