C29H30ClN5O4S — CID 43883996
N-(3-chloro-4-morpholin-4-ylphenyl)-2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 43883996) has the molecular formula C29H30ClN5O4S and a molecular weight of 580.11 g/mol. Its IUPAC name is N-(3-chloro-4-morpholin-4-ylphenyl)-2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-chloro-4-morpholin-4-ylphenyl)-2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 43883996 |
| Molecular Formula | C29H30ClN5O4S |
| Molecular Weight | 580.11 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | N-(3-chloro-4-morpholin-4-ylphenyl)-2-[[5-[1-(4-methoxyphenoxy)ethyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(OC(C)c2nnc(SCC(=O)Nc3ccc(N4CCOCC4)c(Cl)c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30ClN5O4S/c1-20(39-24-11-9-23(37-2)10-12-24)28-32-33-29(35(28)22-6-4-3-5-7-22)40-19-27(36)31-21-8-13-26(25(30)18-21)34-14-16-38-17-15-34/h3-13,18,20H,14-17,19H2,1-2H3,(H,31,36) |
| InChIKey | CKOIWXBQZKJLCT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.11 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|