C25H27ClN4O3S — CID 43884728
N-(3-acetylphenyl)-2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 43884728) has the molecular formula C25H27ClN4O3S and a molecular weight of 499.04 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-(3-acetylphenyl)-2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 43884728 |
| Molecular Formula | C25H27ClN4O3S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-(3-acetylphenyl)-2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | C=CCn1c(SC(CC)C(=O)Nc2cccc(C(C)=O)c2)nnc1C(C)Oc1ccccc1Cl |
| InChI | InChI=1S/C25H27ClN4O3S/c1-5-14-30-23(17(4)33-21-13-8-7-12-20(21)26)28-29-25(30)34-22(6-2)24(32)27-19-11-9-10-18(15-19)16(3)31/h5,7-13,15,17,22H,1,6,14H2,2-4H3,(H,27,32) |
| InChIKey | CULAZWNTBPNXES-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|