C23H27FN2O3 — CID 43886444
N-cyclohexyl-2-[2-(4-fluorophenoxy)butanoylamino]benzamide (PubChem CID 43886444) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-(4-fluorophenoxy)butanoylamino]benzamide.
| Compound Name | N-cyclohexyl-2-[2-(4-fluorophenoxy)butanoylamino]benzamide |
|---|---|
| PubChem CID | 43886444 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-cyclohexyl-2-[2-(4-fluorophenoxy)butanoylamino]benzamide |
| SMILES | CCC(Oc1ccc(F)cc1)C(=O)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H27FN2O3/c1-2-21(29-18-14-12-16(24)13-15-18)23(28)26-20-11-7-6-10-19(20)22(27)25-17-8-4-3-5-9-17/h6-7,10-15,17,21H,2-5,8-9H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | SELTZGFOFSXRQR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |