C24H23F3N2O4S — CID 43889132
2-[(4-ethoxy-3-methylphenyl)sulfonylamino]-3-phenyl-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 43889132) has the molecular formula C24H23F3N2O4S and a molecular weight of 492.52 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-methylphenyl)sulfonylamino]-3-phenyl-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 2-[(4-ethoxy-3-methylphenyl)sulfonylamino]-3-phenyl-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 43889132 |
| Molecular Formula | C24H23F3N2O4S |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-[(4-ethoxy-3-methylphenyl)sulfonylamino]-3-phenyl-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)Nc2ccc(F)c(F)c2F)cc1C |
| InChI | InChI=1S/C24H23F3N2O4S/c1-3-33-21-12-9-17(13-15(21)2)34(31,32)29-20(14-16-7-5-4-6-8-16)24(30)28-19-11-10-18(25)22(26)23(19)27/h4-13,20,29H,3,14H2,1-2H3,(H,28,30) |
| InChIKey | SFXZSIGWDDIROR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|