C25H28N4O4S — CID 43889564
1-(4-methylphenyl)sulfonyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-prop-2-enylpiperidine-3-carboxamide (PubChem CID 43889564) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43889564 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-N-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCN(Cc1nc(-c2ccccc2)no1)C(=O)C1CCCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C25H28N4O4S/c1-3-15-28(18-23-26-24(27-33-23)20-8-5-4-6-9-20)25(30)21-10-7-16-29(17-21)34(31,32)22-13-11-19(2)12-14-22/h3-6,8-9,11-14,21H,1,7,10,15-18H2,2H3 |
| InChIKey | XUXCYCRFRCSPLW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|