C19H23ClN2O5S2 — CID 43895447
2-(3-chloro-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)propyl]acetamide (PubChem CID 43895447) has the molecular formula C19H23ClN2O5S2 and a molecular weight of 458.99 g/mol. Its IUPAC name is 2-(3-chloro-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)propyl]acetamide.
| Compound Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 43895447 |
| Molecular Formula | C19H23ClN2O5S2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)propyl]acetamide |
| SMILES | CCC(NC(=O)CN(c1cccc(Cl)c1)S(C)(=O)=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H23ClN2O5S2/c1-4-18(14-8-10-17(11-9-14)28(2,24)25)21-19(23)13-22(29(3,26)27)16-7-5-6-15(20)12-16/h5-12,18H,4,13H2,1-3H3,(H,21,23) |
| InChIKey | DDFUHDHQRVNTPK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |