C21H23Cl3N2O4S — CID 43898435
2-(2,4,5-trichloro-N-methylsulfonylanilino)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)acetamide (PubChem CID 43898435) has the molecular formula C21H23Cl3N2O4S and a molecular weight of 505.85 g/mol. Its IUPAC name is 2-(2,4,5-trichloro-N-methylsulfonylanilino)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)acetamide.
| Compound Name | 2-(2,4,5-trichloro-N-methylsulfonylanilino)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)acetamide |
|---|---|
| PubChem CID | 43898435 |
| Molecular Formula | C21H23Cl3N2O4S |
| Molecular Weight | 505.85 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 2-(2,4,5-trichloro-N-methylsulfonylanilino)-N-(2,2,6-trimethyl-3,4-dihydrochromen-4-yl)acetamide |
| SMILES | Cc1ccc2c(c1)C(NC(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O)CC(C)(C)O2 |
| InChI | InChI=1S/C21H23Cl3N2O4S/c1-12-5-6-19-13(7-12)17(10-21(2,3)30-19)25-20(27)11-26(31(4,28)29)18-9-15(23)14(22)8-16(18)24/h5-9,17H,10-11H2,1-4H3,(H,25,27) |
| InChIKey | UKRXAAAMLYMSIW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|